About copper(1+);triphenylphosphane;bromide
copper(1+);triphenylphosphane;bromide (PubChem CID 87491658) has the molecular formula C18H15BrCuP
and a molecular weight of 405.74 g/mol. Its IUPAC name is copper(1+);triphenylphosphane;bromide.
Molecular Properties
| Compound Name | copper(1+);triphenylphosphane;bromide |
| PubChem CID | 87491658 |
| Molecular Formula | C18H15BrCuP |
| Molecular Weight | 405.74 g/mol |
| Exact Mass | 403.94 |
| IUPAC Name | copper(1+);triphenylphosphane;bromide |
| SMILES | [Br-].[Cu+].c1ccc(P(c2ccccc2)c2ccccc2)cc1 |
| InChI | InChI=1S/C18H15P.BrH.Cu/c1-4-10-16(11-5-1)19(17-12-6-2-7-13-17)18-14-8-3-9-15-18;;/h1-15H;1H;/q;;+1/p-1 |
| InChIKey | TUPXJWBWBIYCNO-UHFFFAOYSA-M |
| XLogP | 0.45 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 3 |
| Heavy Atoms | 21 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 405.74 |
| LogP ≤ 5 | 0.45 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|
Analyze copper(1+);triphenylphosphane;bromide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of copper(1+);triphenylphosphane;bromide?
The IUPAC name of copper(1+);triphenylphosphane;bromide (CID 87491658) is copper(1+);triphenylphosphane;bromide.
What is the SMILES notation for copper(1+);triphenylphosphane;bromide?
The canonical SMILES for copper(1+);triphenylphosphane;bromide is [Br-].[Cu+].c1ccc(P(c2ccccc2)c2ccccc2)cc1.
What is the InChIKey of copper(1+);triphenylphosphane;bromide?
The InChIKey is TUPXJWBWBIYCNO-UHFFFAOYSA-M. The full InChI is InChI=1S/C18H15P.BrH.Cu/c1-4-10-16(11-5-1)19(17-12-6-2-7-13-17)18-14-8-3-9-15-18;;/h1-15H;1H;/q;;+1/p-1.
What are the key properties of copper(1+);triphenylphosphane;bromide?
copper(1+);triphenylphosphane;bromide has a molecular weight of 405.74 g/mol, XLogP of 0.45, 3 rotatable bonds, 0 hydrogen bond donors, and 0 hydrogen bond acceptors.
Where does this data come from?
All data for copper(1+);triphenylphosphane;bromide is sourced from PubChem (CID 87491658), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).