C27H40O12 — CID 87496056
[(3R,4R,5R,6S,7S)-3,5,6,7,8-pentakis(methylperoxy)-4-phenylmethoxyoctan-2-yl]oxymethylbenzene (PubChem CID 87496056) has the molecular formula C27H40O12 and a molecular weight of 556.61 g/mol. Its IUPAC name is [(3R,4R,5R,6S,7S)-3,5,6,7,8-pentakis(methylperoxy)-4-phenylmethoxyoctan-2-yl]oxymethylbenzene.
| Compound Name | [(3R,4R,5R,6S,7S)-3,5,6,7,8-pentakis(methylperoxy)-4-phenylmethoxyoctan-2-yl]oxymethylbenzene |
|---|---|
| PubChem CID | 87496056 |
| Molecular Formula | C27H40O12 |
| Molecular Weight | 556.61 g/mol |
| Exact Mass | 556.25 |
| IUPAC Name | [(3R,4R,5R,6S,7S)-3,5,6,7,8-pentakis(methylperoxy)-4-phenylmethoxyoctan-2-yl]oxymethylbenzene |
| SMILES | COOC[C@H](OOC)[C@H](OOC)[C@H](OOC)[C@H](OCc1ccccc1)[C@H](OOC)C(C)OCc1ccccc1 |
| InChI | InChI=1S/C27H40O12/c1-20(33-17-21-13-9-7-10-14-21)24(37-30-4)26(34-18-22-15-11-8-12-16-22)27(39-32-6)25(38-31-5)23(36-29-3)19-35-28-2/h7-16,20,23-27H,17-19H2,1-6H3/t20?,23-,24+,25-,26+,27-/m0/s1 |
| InChIKey | KYEWKSYYCFDSHC-WBIDQBDMSA-N |
| XLogP | 3.54 |
| TPSA | 110.76 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 12 |
| Rotatable Bonds | 22 |
| Heavy Atoms | 39 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 556.61 |
| LogP ≤ 5 | 3.54 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 12 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'peroxide', 'substructure': 'N/A'} |
|---|