C24H34O9 — CID 87496260
(2S,3R,4R,5R,6R)-1-methoxy-4,6-bis(methylperoxy)-5,7-bis(phenylmethoxy)heptane-2,3-diol (PubChem CID 87496260) has the molecular formula C24H34O9 and a molecular weight of 466.53 g/mol. Its IUPAC name is (2S,3R,4R,5R,6R)-1-methoxy-4,6-bis(methylperoxy)-5,7-bis(phenylmethoxy)heptane-2,3-diol.
| Compound Name | (2S,3R,4R,5R,6R)-1-methoxy-4,6-bis(methylperoxy)-5,7-bis(phenylmethoxy)heptane-2,3-diol |
|---|---|
| PubChem CID | 87496260 |
| Molecular Formula | C24H34O9 |
| Molecular Weight | 466.53 g/mol |
| Exact Mass | 466.22 |
| IUPAC Name | (2S,3R,4R,5R,6R)-1-methoxy-4,6-bis(methylperoxy)-5,7-bis(phenylmethoxy)heptane-2,3-diol |
| SMILES | COC[C@H](O)[C@@H](O)[C@@H](OOC)[C@H](OCc1ccccc1)[C@@H](COCc1ccccc1)OOC |
| InChI | InChI=1S/C24H34O9/c1-27-16-20(25)22(26)24(33-29-3)23(31-15-19-12-8-5-9-13-19)21(32-28-2)17-30-14-18-10-6-4-7-11-18/h4-13,20-26H,14-17H2,1-3H3/t20-,21+,22+,23+,24+/m0/s1 |
| InChIKey | RMZKMPIPJBUFKB-ODTAKUCXSA-N |
| XLogP | 2.05 |
| TPSA | 105.07 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 17 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 466.53 |
| LogP ≤ 5 | 2.05 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'peroxide', 'substructure': 'N/A'} |
|---|