C15H16ClN3O2S — CID 87498028
1-(6-chloropyrimidin-4-yl)-5-propylsulfonyl-2,3-dihydroindole (PubChem CID 87498028) has the molecular formula C15H16ClN3O2S and a molecular weight of 337.83 g/mol. Its IUPAC name is 1-(6-chloropyrimidin-4-yl)-5-propylsulfonyl-2,3-dihydroindole.
| Compound Name | 1-(6-chloropyrimidin-4-yl)-5-propylsulfonyl-2,3-dihydroindole |
|---|---|
| PubChem CID | 87498028 |
| Molecular Formula | C15H16ClN3O2S |
| Molecular Weight | 337.83 g/mol |
| Exact Mass | 337.07 |
| IUPAC Name | 1-(6-chloropyrimidin-4-yl)-5-propylsulfonyl-2,3-dihydroindole |
| SMILES | CCCS(=O)(=O)c1ccc2c(c1)CCN2c1cc(Cl)ncn1 |
| InChI | InChI=1S/C15H16ClN3O2S/c1-2-7-22(20,21)12-3-4-13-11(8-12)5-6-19(13)15-9-14(16)17-10-18-15/h3-4,8-10H,2,5-7H2,1H3 |
| InChIKey | YRLLAYAZUSIYRY-UHFFFAOYSA-N |
| XLogP | 3.01 |
| TPSA | 63.16 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 337.83 |
| LogP ≤ 5 | 3.01 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |