C9H21N3O — CID 87500592
N,N',N'-trimethyl-3-(propylamino)propanehydrazide (PubChem CID 87500592) has the molecular formula C9H21N3O and a molecular weight of 187.29 g/mol. Its IUPAC name is N,N',N'-trimethyl-3-(propylamino)propanehydrazide.
| Compound Name | N,N',N'-trimethyl-3-(propylamino)propanehydrazide |
|---|---|
| PubChem CID | 87500592 |
| Molecular Formula | C9H21N3O |
| Molecular Weight | 187.29 g/mol |
| Exact Mass | 187.17 |
| IUPAC Name | N,N',N'-trimethyl-3-(propylamino)propanehydrazide |
| SMILES | CCCNCCC(=O)N(C)N(C)C |
| InChI | InChI=1S/C9H21N3O/c1-5-7-10-8-6-9(13)12(4)11(2)3/h10H,5-8H2,1-4H3 |
| InChIKey | MBUXFVBTRJJLGL-UHFFFAOYSA-N |
| XLogP | 0.31 |
| TPSA | 35.58 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 187.29 |
| LogP ≤ 5 | 0.31 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|