C17H18AsNO — CID 87501562
CID 87501562 (PubChem CID 87501562) has the molecular formula C17H18AsNO and a molecular weight of 327.26 g/mol.
| Compound Name | CID 87501562 |
|---|---|
| PubChem CID | 87501562 |
| Molecular Formula | C17H18AsNO |
| Molecular Weight | 327.26 g/mol |
| Exact Mass | 327.06 |
| IUPAC Name | — |
| SMILES | Cc1cccc(-c2cncc(OCC3(C[As])CC3)c2)c1 |
| InChI | InChI=1S/C17H18AsNO/c1-13-3-2-4-14(7-13)15-8-16(10-19-9-15)20-12-17(11-18)5-6-17/h2-4,7-10H,5-6,11-12H2,1H3 |
| InChIKey | YDWWJPJODJTFAB-UHFFFAOYSA-N |
| XLogP | 3.80 |
| TPSA | 22.12 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 327.26 |
| LogP ≤ 5 | 3.80 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|