C13H11Cl2NO2 — CID 87508268
ethyl 4,5-dichloro-1-isocyano-2,3-dihydro-1H-indene-2-carboxylate (PubChem CID 87508268) has the molecular formula C13H11Cl2NO2 and a molecular weight of 284.14 g/mol. Its IUPAC name is ethyl 4,5-dichloro-1-isocyano-2,3-dihydro-1H-indene-2-carboxylate.
| Compound Name | ethyl 4,5-dichloro-1-isocyano-2,3-dihydro-1H-indene-2-carboxylate |
|---|---|
| PubChem CID | 87508268 |
| Molecular Formula | C13H11Cl2NO2 |
| Molecular Weight | 284.14 g/mol |
| Exact Mass | 283.02 |
| IUPAC Name | ethyl 4,5-dichloro-1-isocyano-2,3-dihydro-1H-indene-2-carboxylate |
| SMILES | [C-]#[N+]C1c2ccc(Cl)c(Cl)c2CC1C(=O)OCC |
| InChI | InChI=1S/C13H11Cl2NO2/c1-3-18-13(17)9-6-8-7(12(9)16-2)4-5-10(14)11(8)15/h4-5,9,12H,3,6H2,1H3 |
| InChIKey | TWTNWIUXAXNNFM-UHFFFAOYSA-N |
| XLogP | 3.69 |
| TPSA | 30.66 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 284.14 |
| LogP ≤ 5 | 3.69 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'} |
|---|