About 2-(4-ethenylphenyl)propane-1,3-dithiol
2-(4-ethenylphenyl)propane-1,3-dithiol (PubChem CID 87508492) has the molecular formula C11H14S2
and a molecular weight of 210.37 g/mol. Its IUPAC name is 2-(4-ethenylphenyl)propane-1,3-dithiol.
Molecular Properties
| Compound Name | 2-(4-ethenylphenyl)propane-1,3-dithiol |
| PubChem CID | 87508492 |
| Molecular Formula | C11H14S2 |
| Molecular Weight | 210.37 g/mol |
| Exact Mass | 210.05 |
| IUPAC Name | 2-(4-ethenylphenyl)propane-1,3-dithiol |
| SMILES | C=Cc1ccc(C(CS)CS)cc1 |
| InChI | InChI=1S/C11H14S2/c1-2-9-3-5-10(6-4-9)11(7-12)8-13/h2-6,11-13H,1,7-8H2 |
| InChIKey | MYEKCIOLKQWDSO-UHFFFAOYSA-N |
| XLogP | 3.27 |
| TPSA | 0.00 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 13 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 210.37 |
| LogP ≤ 5 | 3.27 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'thiol_2', 'substructure': 'N/A'} |
|---|
Analyze 2-(4-ethenylphenyl)propane-1,3-dithiol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-(4-ethenylphenyl)propane-1,3-dithiol?
The IUPAC name of 2-(4-ethenylphenyl)propane-1,3-dithiol (CID 87508492) is 2-(4-ethenylphenyl)propane-1,3-dithiol.
What is the SMILES notation for 2-(4-ethenylphenyl)propane-1,3-dithiol?
The canonical SMILES for 2-(4-ethenylphenyl)propane-1,3-dithiol is C=Cc1ccc(C(CS)CS)cc1.
What is the InChIKey of 2-(4-ethenylphenyl)propane-1,3-dithiol?
The InChIKey is MYEKCIOLKQWDSO-UHFFFAOYSA-N. The full InChI is InChI=1S/C11H14S2/c1-2-9-3-5-10(6-4-9)11(7-12)8-13/h2-6,11-13H,1,7-8H2.
What are the key properties of 2-(4-ethenylphenyl)propane-1,3-dithiol?
2-(4-ethenylphenyl)propane-1,3-dithiol has a molecular weight of 210.37 g/mol, XLogP of 3.27, 4 rotatable bonds, 2 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 2-(4-ethenylphenyl)propane-1,3-dithiol is sourced from PubChem (CID 87508492), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).