C11H14S2 — CID 87508492
2-(4-ethenylphenyl)propane-1,3-dithiol (PubChem CID 87508492) has the molecular formula C11H14S2 and a molecular weight of 210.37 g/mol. Its IUPAC name is 2-(4-ethenylphenyl)propane-1,3-dithiol.
| Compound Name | 2-(4-ethenylphenyl)propane-1,3-dithiol |
|---|---|
| PubChem CID | 87508492 |
| Molecular Formula | C11H14S2 |
| Molecular Weight | 210.37 g/mol |
| Exact Mass | 210.05 |
| IUPAC Name | 2-(4-ethenylphenyl)propane-1,3-dithiol |
| SMILES | C=Cc1ccc(C(CS)CS)cc1 |
| InChI | InChI=1S/C11H14S2/c1-2-9-3-5-10(6-4-9)11(7-12)8-13/h2-6,11-13H,1,7-8H2 |
| InChIKey | MYEKCIOLKQWDSO-UHFFFAOYSA-N |
| XLogP | 3.27 |
| TPSA | 0.00 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 210.37 |
| LogP ≤ 5 | 3.27 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'thiol_2', 'substructure': 'N/A'} |
|---|