About butanoyl chloride;2-hydroxyethyl(trimethyl)azanium
butanoyl chloride;2-hydroxyethyl(trimethyl)azanium (PubChem CID 87508562) has the molecular formula C9H21ClNO2+
and a molecular weight of 210.72 g/mol. Its IUPAC name is butanoyl chloride;2-hydroxyethyl(trimethyl)azanium.
Molecular Properties
| Compound Name | butanoyl chloride;2-hydroxyethyl(trimethyl)azanium |
| PubChem CID | 87508562 |
| Molecular Formula | C9H21ClNO2+ |
| Molecular Weight | 210.72 g/mol |
| Exact Mass | 210.13 |
| IUPAC Name | butanoyl chloride;2-hydroxyethyl(trimethyl)azanium |
| SMILES | CCCC(=O)Cl.C[N+](C)(C)CCO |
| InChI | InChI=1S/C5H14NO.C4H7ClO/c1-6(2,3)4-5-7;1-2-3-4(5)6/h7H,4-5H2,1-3H3;2-3H2,1H3/q+1; |
| InChIKey | BBTXCKOKSVFMPJ-UHFFFAOYSA-N |
| XLogP | 1.24 |
| TPSA | 37.30 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 13 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 210.72 |
| LogP ≤ 5 | 1.24 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'acid_halide', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_2', 'substructure': 'N/A'} |
|---|
Analyze butanoyl chloride;2-hydroxyethyl(trimethyl)azanium with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of butanoyl chloride;2-hydroxyethyl(trimethyl)azanium?
The IUPAC name of butanoyl chloride;2-hydroxyethyl(trimethyl)azanium (CID 87508562) is butanoyl chloride;2-hydroxyethyl(trimethyl)azanium.
What is the SMILES notation for butanoyl chloride;2-hydroxyethyl(trimethyl)azanium?
The canonical SMILES for butanoyl chloride;2-hydroxyethyl(trimethyl)azanium is CCCC(=O)Cl.C[N+](C)(C)CCO.
What is the InChIKey of butanoyl chloride;2-hydroxyethyl(trimethyl)azanium?
The InChIKey is BBTXCKOKSVFMPJ-UHFFFAOYSA-N. The full InChI is InChI=1S/C5H14NO.C4H7ClO/c1-6(2,3)4-5-7;1-2-3-4(5)6/h7H,4-5H2,1-3H3;2-3H2,1H3/q+1;.
What are the key properties of butanoyl chloride;2-hydroxyethyl(trimethyl)azanium?
butanoyl chloride;2-hydroxyethyl(trimethyl)azanium has a molecular weight of 210.72 g/mol, XLogP of 1.24, 4 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for butanoyl chloride;2-hydroxyethyl(trimethyl)azanium is sourced from PubChem (CID 87508562), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).