About 2-cyanoacetyl chloride;2-hydroxyethyl(trimethyl)azanium
2-cyanoacetyl chloride;2-hydroxyethyl(trimethyl)azanium (PubChem CID 88818489) has the molecular formula C8H16ClN2O2+
and a molecular weight of 207.68 g/mol. Its IUPAC name is 2-cyanoacetyl chloride;2-hydroxyethyl(trimethyl)azanium.
Molecular Properties
| Compound Name | 2-cyanoacetyl chloride;2-hydroxyethyl(trimethyl)azanium |
| PubChem CID | 88818489 |
| Molecular Formula | C8H16ClN2O2+ |
| Molecular Weight | 207.68 g/mol |
| Exact Mass | 207.09 |
| IUPAC Name | 2-cyanoacetyl chloride;2-hydroxyethyl(trimethyl)azanium |
| SMILES | C[N+](C)(C)CCO.N#CCC(=O)Cl |
| InChI | InChI=1S/C5H14NO.C3H2ClNO/c1-6(2,3)4-5-7;4-3(6)1-2-5/h7H,4-5H2,1-3H3;1H2/q+1; |
| InChIKey | VRCICJWRRZSOCD-UHFFFAOYSA-N |
| XLogP | 0.35 |
| TPSA | 61.09 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 13 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 207.68 |
| LogP ≤ 5 | 0.35 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'acid_halide', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_2', 'substructure': 'N/A'} |
|---|
Analyze 2-cyanoacetyl chloride;2-hydroxyethyl(trimethyl)azanium with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-cyanoacetyl chloride;2-hydroxyethyl(trimethyl)azanium?
The IUPAC name of 2-cyanoacetyl chloride;2-hydroxyethyl(trimethyl)azanium (CID 88818489) is 2-cyanoacetyl chloride;2-hydroxyethyl(trimethyl)azanium.
What is the SMILES notation for 2-cyanoacetyl chloride;2-hydroxyethyl(trimethyl)azanium?
The canonical SMILES for 2-cyanoacetyl chloride;2-hydroxyethyl(trimethyl)azanium is C[N+](C)(C)CCO.N#CCC(=O)Cl.
What is the InChIKey of 2-cyanoacetyl chloride;2-hydroxyethyl(trimethyl)azanium?
The InChIKey is VRCICJWRRZSOCD-UHFFFAOYSA-N. The full InChI is InChI=1S/C5H14NO.C3H2ClNO/c1-6(2,3)4-5-7;4-3(6)1-2-5/h7H,4-5H2,1-3H3;1H2/q+1;.
What are the key properties of 2-cyanoacetyl chloride;2-hydroxyethyl(trimethyl)azanium?
2-cyanoacetyl chloride;2-hydroxyethyl(trimethyl)azanium has a molecular weight of 207.68 g/mol, XLogP of 0.35, 3 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 2-cyanoacetyl chloride;2-hydroxyethyl(trimethyl)azanium is sourced from PubChem (CID 88818489), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).