C23H37ClN4O6 — CID 87519159
tert-butyl N-[3-(2-chloro-5-cyclopropylpyrimidin-4-yl)oxypropyl]-N-[3-hydroxy-1-[(2-methylpropan-2-yl)oxycarbonylamino]propyl]carbamate (PubChem CID 87519159) has the molecular formula C23H37ClN4O6 and a molecular weight of 501.02 g/mol. Its IUPAC name is tert-butyl N-[3-(2-chloro-5-cyclopropylpyrimidin-4-yl)oxypropyl]-N-[3-hydroxy-1-[(2-methylpropan-2-yl)oxycarbonylamino]propyl]carbamate.
| Compound Name | tert-butyl N-[3-(2-chloro-5-cyclopropylpyrimidin-4-yl)oxypropyl]-N-[3-hydroxy-1-[(2-methylpropan-2-yl)oxycarbonylamino]propyl]carbamate |
|---|---|
| PubChem CID | 87519159 |
| Molecular Formula | C23H37ClN4O6 |
| Molecular Weight | 501.02 g/mol |
| Exact Mass | 500.24 |
| IUPAC Name | tert-butyl N-[3-(2-chloro-5-cyclopropylpyrimidin-4-yl)oxypropyl]-N-[3-hydroxy-1-[(2-methylpropan-2-yl)oxycarbonylamino]propyl]carbamate |
| SMILES | CC(C)(C)OC(=O)NC(CCO)N(CCCOc1nc(Cl)ncc1C1CC1)C(=O)OC(C)(C)C |
| InChI | InChI=1S/C23H37ClN4O6/c1-22(2,3)33-20(30)26-17(10-12-29)28(21(31)34-23(4,5)6)11-7-13-32-18-16(15-8-9-15)14-25-19(24)27-18/h14-15,17,29H,7-13H2,1-6H3,(H,26,30) |
| InChIKey | MLHFAFASPBNHNF-UHFFFAOYSA-N |
| XLogP | 4.25 |
| TPSA | 123.11 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 501.02 |
| LogP ≤ 5 | 4.25 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|