C14H14N2O3S2 — CID 87522818
(E)-3-[5-[(E)-2-(2-acetamido-3H-1,3-thiazol-2-yl)ethenyl]thiophen-3-yl]prop-2-enoic acid (PubChem CID 87522818) has the molecular formula C14H14N2O3S2 and a molecular weight of 322.41 g/mol. Its IUPAC name is (E)-3-[5-[(E)-2-(2-acetamido-3H-1,3-thiazol-2-yl)ethenyl]thiophen-3-yl]prop-2-enoic acid.
| Compound Name | (E)-3-[5-[(E)-2-(2-acetamido-3H-1,3-thiazol-2-yl)ethenyl]thiophen-3-yl]prop-2-enoic acid |
|---|---|
| PubChem CID | 87522818 |
| Molecular Formula | C14H14N2O3S2 |
| Molecular Weight | 322.41 g/mol |
| Exact Mass | 322.04 |
| IUPAC Name | (E)-3-[5-[(E)-2-(2-acetamido-3H-1,3-thiazol-2-yl)ethenyl]thiophen-3-yl]prop-2-enoic acid |
| SMILES | CC(=O)NC1(/C=C/c2cc(/C=C/C(=O)O)cs2)NC=CS1 |
| InChI | InChI=1S/C14H14N2O3S2/c1-10(17)16-14(15-6-7-21-14)5-4-12-8-11(9-20-12)2-3-13(18)19/h2-9,15H,1H3,(H,16,17)(H,18,19)/b3-2+,5-4+ |
| InChIKey | RKVUCDQOVZJDEQ-MQQKCMAXSA-N |
| XLogP | 2.46 |
| TPSA | 78.43 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 322.41 |
| LogP ≤ 5 | 2.46 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|