C28H45O9P — CID 87522859
[1-[(2S)-2-docosa-2,4,6,8,10,12-hexaenoyloxy-3-hydroxypropoxy]-2,3-dihydroxypropyl]phosphonic acid (PubChem CID 87522859) has the molecular formula C28H45O9P and a molecular weight of 556.63 g/mol. Its IUPAC name is [1-[(2S)-2-docosa-2,4,6,8,10,12-hexaenoyloxy-3-hydroxypropoxy]-2,3-dihydroxypropyl]phosphonic acid.
| Compound Name | [1-[(2S)-2-docosa-2,4,6,8,10,12-hexaenoyloxy-3-hydroxypropoxy]-2,3-dihydroxypropyl]phosphonic acid |
|---|---|
| PubChem CID | 87522859 |
| Molecular Formula | C28H45O9P |
| Molecular Weight | 556.63 g/mol |
| Exact Mass | 556.28 |
| IUPAC Name | [1-[(2S)-2-docosa-2,4,6,8,10,12-hexaenoyloxy-3-hydroxypropoxy]-2,3-dihydroxypropyl]phosphonic acid |
| SMILES | CCCCCCCCCC=CC=CC=CC=CC=CC=CC(=O)O[C@@H](CO)COC(C(O)CO)P(=O)(O)O |
| InChI | InChI=1S/C28H45O9P/c1-2-3-4-5-6-7-8-9-10-11-12-13-14-15-16-17-18-19-20-21-27(32)37-25(22-29)24-36-28(26(31)23-30)38(33,34)35/h10-21,25-26,28-31H,2-9,22-24H2,1H3,(H2,33,34,35)/t25-,26?,28?/m0/s1 |
| InChIKey | IPJQWDQGRWGLNY-MRNPYCGKSA-N |
| XLogP | 4.24 |
| TPSA | 153.75 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 22 |
| Heavy Atoms | 38 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 556.63 |
| LogP ≤ 5 | 4.24 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|