C42H83O8P — CID 87503209
[1-[(2R)-2,3-bis[(Z)-octadec-9-enoxy]propoxy]-2,3-dihydroxypropyl]phosphonic acid (PubChem CID 87503209) has the molecular formula C42H83O8P and a molecular weight of 747.09 g/mol. Its IUPAC name is [1-[(2R)-2,3-bis[(Z)-octadec-9-enoxy]propoxy]-2,3-dihydroxypropyl]phosphonic acid.
| Compound Name | [1-[(2R)-2,3-bis[(Z)-octadec-9-enoxy]propoxy]-2,3-dihydroxypropyl]phosphonic acid |
|---|---|
| PubChem CID | 87503209 |
| Molecular Formula | C42H83O8P |
| Molecular Weight | 747.09 g/mol |
| Exact Mass | 746.58 |
| IUPAC Name | [1-[(2R)-2,3-bis[(Z)-octadec-9-enoxy]propoxy]-2,3-dihydroxypropyl]phosphonic acid |
| SMILES | CCCCCCCC/C=C\CCCCCCCCOC[C@H](COC(C(O)CO)P(=O)(O)O)OCCCCCCCC/C=C\CCCCCCCC |
| InChI | InChI=1S/C42H83O8P/c1-3-5-7-9-11-13-15-17-19-21-23-25-27-29-31-33-35-48-38-40(39-50-42(41(44)37-43)51(45,46)47)49-36-34-32-30-28-26-24-22-20-18-16-14-12-10-8-6-4-2/h17-20,40-44H,3-16,21-39H2,1-2H3,(H2,45,46,47)/b19-17-,20-18-/t40-,41?,42?/m1/s1 |
| InChIKey | ILMCTTFVDDQPJO-NYSLQNTISA-N |
| XLogP | 11.34 |
| TPSA | 125.68 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 41 |
| Heavy Atoms | 51 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 747.09 |
| LogP ≤ 5 | 11.34 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|