C32H52N2O6 — CID 87523697
(dicyclohexylamino) 2-[(2S)-2-[(2-methylpropan-2-yl)oxycarbonylamino]-6-phenylmethoxyhexoxy]acetate (PubChem CID 87523697) has the molecular formula C32H52N2O6 and a molecular weight of 560.78 g/mol. Its IUPAC name is (dicyclohexylamino) 2-[(2S)-2-[(2-methylpropan-2-yl)oxycarbonylamino]-6-phenylmethoxyhexoxy]acetate.
| Compound Name | (dicyclohexylamino) 2-[(2S)-2-[(2-methylpropan-2-yl)oxycarbonylamino]-6-phenylmethoxyhexoxy]acetate |
|---|---|
| PubChem CID | 87523697 |
| Molecular Formula | C32H52N2O6 |
| Molecular Weight | 560.78 g/mol |
| Exact Mass | 560.38 |
| IUPAC Name | (dicyclohexylamino) 2-[(2S)-2-[(2-methylpropan-2-yl)oxycarbonylamino]-6-phenylmethoxyhexoxy]acetate |
| SMILES | CC(C)(C)OC(=O)N[C@@H](CCCCOCc1ccccc1)COCC(=O)ON(C1CCCCC1)C1CCCCC1 |
| InChI | InChI=1S/C32H52N2O6/c1-32(2,3)39-31(36)33-27(17-13-14-22-37-23-26-15-7-4-8-16-26)24-38-25-30(35)40-34(28-18-9-5-10-19-28)29-20-11-6-12-21-29/h4,7-8,15-16,27-29H,5-6,9-14,17-25H2,1-3H3,(H,33,36)/t27-/m0/s1 |
| InChIKey | CJYVJZPHDACDPU-MHZLTWQESA-N |
| XLogP | 6.71 |
| TPSA | 86.33 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 15 |
| Heavy Atoms | 40 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 560.78 |
| LogP ≤ 5 | 6.71 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|