C34H58N4O8 — CID 126567982
tert-butyl N-[(5S)-5-[[(2S)-2,6-bis[(2-methylpropan-2-yl)oxycarbonylamino]hexanoyl]amino]-6-phenylmethoxyhexyl]carbamate (PubChem CID 126567982) has the molecular formula C34H58N4O8 and a molecular weight of 650.86 g/mol. Its IUPAC name is tert-butyl N-[(5S)-5-[[(2S)-2,6-bis[(2-methylpropan-2-yl)oxycarbonylamino]hexanoyl]amino]-6-phenylmethoxyhexyl]carbamate.
| Compound Name | tert-butyl N-[(5S)-5-[[(2S)-2,6-bis[(2-methylpropan-2-yl)oxycarbonylamino]hexanoyl]amino]-6-phenylmethoxyhexyl]carbamate |
|---|---|
| PubChem CID | 126567982 |
| Molecular Formula | C34H58N4O8 |
| Molecular Weight | 650.86 g/mol |
| Exact Mass | 650.43 |
| IUPAC Name | tert-butyl N-[(5S)-5-[[(2S)-2,6-bis[(2-methylpropan-2-yl)oxycarbonylamino]hexanoyl]amino]-6-phenylmethoxyhexyl]carbamate |
| SMILES | CC(C)(C)OC(=O)NCCCC[C@@H](COCc1ccccc1)NC(=O)[C@H](CCCCNC(=O)OC(C)(C)C)NC(=O)OC(C)(C)C |
| InChI | InChI=1S/C34H58N4O8/c1-32(2,3)44-29(40)35-21-15-13-19-26(24-43-23-25-17-11-10-12-18-25)37-28(39)27(38-31(42)46-34(7,8)9)20-14-16-22-36-30(41)45-33(4,5)6/h10-12,17-18,26-27H,13-16,19-24H2,1-9H3,(H,35,40)(H,36,41)(H,37,39)(H,38,42)/t26-,27-/m0/s1 |
| InChIKey | DSLOXRSIPCJEGI-SVBPBHIXSA-N |
| XLogP | 5.97 |
| TPSA | 153.32 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 17 |
| Heavy Atoms | 46 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 650.86 |
| LogP ≤ 5 | 5.97 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|