C9H6Cl2F3NO3S — CID 87526209
(NE)-N-[1-[chloro-(4-chlorophenyl)methyl]sulfonyl-2,2,2-trifluoroethylidene]hydroxylamine (PubChem CID 87526209) has the molecular formula C9H6Cl2F3NO3S and a molecular weight of 336.12 g/mol. Its IUPAC name is (NE)-N-[1-[chloro-(4-chlorophenyl)methyl]sulfonyl-2,2,2-trifluoroethylidene]hydroxylamine.
| Compound Name | (NE)-N-[1-[chloro-(4-chlorophenyl)methyl]sulfonyl-2,2,2-trifluoroethylidene]hydroxylamine |
|---|---|
| PubChem CID | 87526209 |
| Molecular Formula | C9H6Cl2F3NO3S |
| Molecular Weight | 336.12 g/mol |
| Exact Mass | 334.94 |
| IUPAC Name | (NE)-N-[1-[chloro-(4-chlorophenyl)methyl]sulfonyl-2,2,2-trifluoroethylidene]hydroxylamine |
| SMILES | O=S(=O)(/C(=N/O)C(F)(F)F)C(Cl)c1ccc(Cl)cc1 |
| InChI | InChI=1S/C9H6Cl2F3NO3S/c10-6-3-1-5(2-4-6)7(11)19(17,18)8(15-16)9(12,13)14/h1-4,7,16H/b15-8+ |
| InChIKey | SXPPLEMNSIHHLA-OVCLIPMQSA-N |
| XLogP | 3.34 |
| TPSA | 66.73 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 336.12 |
| LogP ≤ 5 | 3.34 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'oxime_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|