C26H40O6 — CID 87529255
(4R)-4-[(3S,7S,8R,9S,10S,13R,14S,17R)-3,7-diformyl-3,7-dihydroxy-10,13-dimethyl-2,4,5,6,8,9,11,12,14,15,16,17-dodecahydro-1H-cyclopenta[a]phenanthren-17-yl]pentanoic acid (PubChem CID 87529255) has the molecular formula C26H40O6 and a molecular weight of 448.60 g/mol. Its IUPAC name is (4R)-4-[(3S,7S,8R,9S,10S,13R,14S,17R)-3,7-diformyl-3,7-dihydroxy-10,13-dimethyl-2,4,5,6,8,9,11,12,14,15,16,17-dodecahydro-1H-cyclopenta[a]phenanthren-17-yl]pentanoic acid.
| Compound Name | (4R)-4-[(3S,7S,8R,9S,10S,13R,14S,17R)-3,7-diformyl-3,7-dihydroxy-10,13-dimethyl-2,4,5,6,8,9,11,12,14,15,16,17-dodecahydro-1H-cyclopenta[a]phenanthren-17-yl]pentanoic acid |
|---|---|
| PubChem CID | 87529255 |
| Molecular Formula | C26H40O6 |
| Molecular Weight | 448.60 g/mol |
| Exact Mass | 448.28 |
| IUPAC Name | (4R)-4-[(3S,7S,8R,9S,10S,13R,14S,17R)-3,7-diformyl-3,7-dihydroxy-10,13-dimethyl-2,4,5,6,8,9,11,12,14,15,16,17-dodecahydro-1H-cyclopenta[a]phenanthren-17-yl]pentanoic acid |
| SMILES | C[C@H](CCC(=O)O)[C@H]1CC[C@H]2[C@H]3[C@H](CC[C@]12C)[C@@]1(C)CC[C@@](O)(C=O)CC1C[C@@]3(O)C=O |
| InChI | InChI=1S/C26H40O6/c1-16(4-7-21(29)30)18-5-6-19-22-20(8-9-24(18,19)3)23(2)10-11-25(31,14-27)12-17(23)13-26(22,32)15-28/h14-20,22,31-32H,4-13H2,1-3H3,(H,29,30)/t16-,17?,18-,19+,20+,22+,23+,24-,25+,26-/m1/s1 |
| InChIKey | QALGNNDOEMRDDJ-RPHVXPQSSA-N |
| XLogP | 3.62 |
| TPSA | 111.90 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 448.60 |
| LogP ≤ 5 | 3.62 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|