C19H14F2N2O3 — CID 87529553
2-N-[(3,5-difluorophenyl)methyl]-2-N-hydroxynaphthalene-2,6-dicarboxamide (PubChem CID 87529553) has the molecular formula C19H14F2N2O3 and a molecular weight of 356.33 g/mol. Its IUPAC name is 2-N-[(3,5-difluorophenyl)methyl]-2-N-hydroxynaphthalene-2,6-dicarboxamide.
| Compound Name | 2-N-[(3,5-difluorophenyl)methyl]-2-N-hydroxynaphthalene-2,6-dicarboxamide |
|---|---|
| PubChem CID | 87529553 |
| Molecular Formula | C19H14F2N2O3 |
| Molecular Weight | 356.33 g/mol |
| Exact Mass | 356.10 |
| IUPAC Name | 2-N-[(3,5-difluorophenyl)methyl]-2-N-hydroxynaphthalene-2,6-dicarboxamide |
| SMILES | NC(=O)c1ccc2cc(C(=O)N(O)Cc3cc(F)cc(F)c3)ccc2c1 |
| InChI | InChI=1S/C19H14F2N2O3/c20-16-5-11(6-17(21)9-16)10-23(26)19(25)15-4-2-12-7-14(18(22)24)3-1-13(12)8-15/h1-9,26H,10H2,(H2,22,24) |
| InChIKey | DFFZVUFHSCTKRY-UHFFFAOYSA-N |
| XLogP | 3.25 |
| TPSA | 83.63 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 356.33 |
| LogP ≤ 5 | 3.25 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'hydroxamic_acid', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|