C28H27FN3O6- — CID 87537176
N-[[(5S)-3-(3-fluoro-4-morpholin-2-ylphenyl)-2-oxo-1,3-oxazolidin-5-yl]methyl]-4-naphthalen-2-yl-N-oxido-4-oxobutanamide (PubChem CID 87537176) has the molecular formula C28H27FN3O6- and a molecular weight of 520.54 g/mol. Its IUPAC name is N-[[(5S)-3-(3-fluoro-4-morpholin-2-ylphenyl)-2-oxo-1,3-oxazolidin-5-yl]methyl]-4-naphthalen-2-yl-N-oxido-4-oxobutanamide.
| Compound Name | N-[[(5S)-3-(3-fluoro-4-morpholin-2-ylphenyl)-2-oxo-1,3-oxazolidin-5-yl]methyl]-4-naphthalen-2-yl-N-oxido-4-oxobutanamide |
|---|---|
| PubChem CID | 87537176 |
| Molecular Formula | C28H27FN3O6- |
| Molecular Weight | 520.54 g/mol |
| Exact Mass | 520.19 |
| IUPAC Name | N-[[(5S)-3-(3-fluoro-4-morpholin-2-ylphenyl)-2-oxo-1,3-oxazolidin-5-yl]methyl]-4-naphthalen-2-yl-N-oxido-4-oxobutanamide |
| SMILES | O=C(CCC(=O)N([O-])C[C@@H]1CN(c2ccc(C3CNCCO3)c(F)c2)C(=O)O1)c1ccc2ccccc2c1 |
| InChI | InChI=1S/C28H27FN3O6/c29-24-14-21(7-8-23(24)26-15-30-11-12-37-26)31-16-22(38-28(31)35)17-32(36)27(34)10-9-25(33)20-6-5-18-3-1-2-4-19(18)13-20/h1-8,13-14,22,26,30H,9-12,15-17H2/q-1/t22-,26?/m0/s1 |
| InChIKey | HMDCRKPVLPPIAD-CHQVSRGASA-N |
| XLogP | 3.95 |
| TPSA | 111.24 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 38 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 520.54 |
| LogP ≤ 5 | 3.95 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|