About methyl 1-[(2R)-1-oxo-1-(3-oxo-2,4-dihydroquinoxalin-1-yl)propan-2-yl]piperidine-4-carboxylate
methyl 1-[(2R)-1-oxo-1-(3-oxo-2,4-dihydroquinoxalin-1-yl)propan-2-yl]piperidine-4-carboxylate (PubChem CID 8754651) has the molecular formula C18H23N3O4
and a molecular weight of 345.40 g/mol. Its IUPAC name is methyl 1-[(2R)-1-oxo-1-(3-oxo-2,4-dihydroquinoxalin-1-yl)propan-2-yl]piperidine-4-carboxylate.
Molecular Properties
| Compound Name | methyl 1-[(2R)-1-oxo-1-(3-oxo-2,4-dihydroquinoxalin-1-yl)propan-2-yl]piperidine-4-carboxylate |
| PubChem CID | 8754651 |
| Molecular Formula | C18H23N3O4 |
| Molecular Weight | 345.40 g/mol |
| Exact Mass | 345.17 |
| IUPAC Name | methyl 1-[(2R)-1-oxo-1-(3-oxo-2,4-dihydroquinoxalin-1-yl)propan-2-yl]piperidine-4-carboxylate |
| SMILES | COC(=O)C1CCN([C@H](C)C(=O)N2CC(=O)Nc3ccccc32)CC1 |
| InChI | InChI=1S/C18H23N3O4/c1-12(20-9-7-13(8-10-20)18(24)25-2)17(23)21-11-16(22)19-14-5-3-4-6-15(14)21/h3-6,12-13H,7-11H2,1-2H3,(H,19,22)/t12-/m1/s1 |
| InChIKey | ZDEZWZKIKMQDAF-GFCCVEGCSA-N |
| XLogP | 1.25 |
| TPSA | 78.95 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 25 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 345.40 |
| LogP ≤ 5 | 1.25 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
Analyze methyl 1-[(2R)-1-oxo-1-(3-oxo-2,4-dihydroquinoxalin-1-yl)propan-2-yl]piperidine-4-carboxylate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of methyl 1-[(2R)-1-oxo-1-(3-oxo-2,4-dihydroquinoxalin-1-yl)propan-2-yl]piperidine-4-carboxylate?
The IUPAC name of methyl 1-[(2R)-1-oxo-1-(3-oxo-2,4-dihydroquinoxalin-1-yl)propan-2-yl]piperidine-4-carboxylate (CID 8754651) is methyl 1-[(2R)-1-oxo-1-(3-oxo-2,4-dihydroquinoxalin-1-yl)propan-2-yl]piperidine-4-carboxylate.
What is the SMILES notation for methyl 1-[(2R)-1-oxo-1-(3-oxo-2,4-dihydroquinoxalin-1-yl)propan-2-yl]piperidine-4-carboxylate?
The canonical SMILES for methyl 1-[(2R)-1-oxo-1-(3-oxo-2,4-dihydroquinoxalin-1-yl)propan-2-yl]piperidine-4-carboxylate is COC(=O)C1CCN([C@H](C)C(=O)N2CC(=O)Nc3ccccc32)CC1.
What is the InChIKey of methyl 1-[(2R)-1-oxo-1-(3-oxo-2,4-dihydroquinoxalin-1-yl)propan-2-yl]piperidine-4-carboxylate?
The InChIKey is ZDEZWZKIKMQDAF-GFCCVEGCSA-N. The full InChI is InChI=1S/C18H23N3O4/c1-12(20-9-7-13(8-10-20)18(24)25-2)17(23)21-11-16(22)19-14-5-3-4-6-15(14)21/h3-6,12-13H,7-11H2,1-2H3,(H,19,22)/t12-/m1/s1.
What are the key properties of methyl 1-[(2R)-1-oxo-1-(3-oxo-2,4-dihydroquinoxalin-1-yl)propan-2-yl]piperidine-4-carboxylate?
methyl 1-[(2R)-1-oxo-1-(3-oxo-2,4-dihydroquinoxalin-1-yl)propan-2-yl]piperidine-4-carboxylate has a molecular weight of 345.40 g/mol, XLogP of 1.25, 3 rotatable bonds, 1 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for methyl 1-[(2R)-1-oxo-1-(3-oxo-2,4-dihydroquinoxalin-1-yl)propan-2-yl]piperidine-4-carboxylate is sourced from PubChem (CID 8754651), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).