C5H11NS3 — CID 87549810
4,4-dimethyltrithian-5-amine (PubChem CID 87549810) has the molecular formula C5H11NS3 and a molecular weight of 181.35 g/mol. Its IUPAC name is 4,4-dimethyltrithian-5-amine.
| Compound Name | 4,4-dimethyltrithian-5-amine |
|---|---|
| PubChem CID | 87549810 |
| Molecular Formula | C5H11NS3 |
| Molecular Weight | 181.35 g/mol |
| Exact Mass | 181.01 |
| IUPAC Name | 4,4-dimethyltrithian-5-amine |
| SMILES | CC1(C)SSSCC1N |
| InChI | InChI=1S/C5H11NS3/c1-5(2)4(6)3-7-9-8-5/h4H,3,6H2,1-2H3 |
| InChIKey | GAXVGBQOYYOJTP-UHFFFAOYSA-N |
| XLogP | 2.14 |
| TPSA | 26.02 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | |
| Heavy Atoms | 9 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 181.35 |
| LogP ≤ 5 | 2.14 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'disulphide', 'substructure': 'N/A'} |
|---|