C14H23N5O7S — CID 87550202
2-[carbamimidoyl(methyl)amino]acetic acid;N-[2-(1H-indol-3-yl)ethyl]hydroxylamine;sulfuric acid (PubChem CID 87550202) has the molecular formula C14H23N5O7S and a molecular weight of 405.43 g/mol. Its IUPAC name is 2-[carbamimidoyl(methyl)amino]acetic acid;N-[2-(1H-indol-3-yl)ethyl]hydroxylamine;sulfuric acid.
| Compound Name | 2-[carbamimidoyl(methyl)amino]acetic acid;N-[2-(1H-indol-3-yl)ethyl]hydroxylamine;sulfuric acid |
|---|---|
| PubChem CID | 87550202 |
| Molecular Formula | C14H23N5O7S |
| Molecular Weight | 405.43 g/mol |
| Exact Mass | 405.13 |
| IUPAC Name | 2-[carbamimidoyl(methyl)amino]acetic acid;N-[2-(1H-indol-3-yl)ethyl]hydroxylamine;sulfuric acid |
| SMILES | O=S(=O)(O)O.ONCCc1c[nH]c2ccccc12.[H]/N=C(\N)N(C)CC(=O)O |
| InChI | InChI=1S/C10H12N2O.C4H9N3O2.H2O4S/c13-12-6-5-8-7-11-10-4-2-1-3-9(8)10;1-7(4(5)6)2-3(8)9;1-5(2,3)4/h1-4,7,11-13H,5-6H2;2H2,1H3,(H3,5,6)(H,8,9);(H2,1,2,3,4) |
| InChIKey | AYZKJKHPRITAGQ-UHFFFAOYSA-N |
| XLogP | -0.07 |
| TPSA | 213.06 Ų |
| H-Bond Donors | 8 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 27 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 405.43 |
| LogP ≤ 5 | -0.07 |
| H-Bond Donors ≤ 5 | 8 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|