C26H40N2O7 — CID 87554128
ethyl (4Z)-4-cyclohexyl-4-hydroxyimino-3-methyl-2-oxobutanoate;ethyl 3-cyclohexyl-4-methyl-1,2-oxazole-5-carboxylate (PubChem CID 87554128) has the molecular formula C26H40N2O7 and a molecular weight of 492.61 g/mol. Its IUPAC name is ethyl (4Z)-4-cyclohexyl-4-hydroxyimino-3-methyl-2-oxobutanoate;ethyl 3-cyclohexyl-4-methyl-1,2-oxazole-5-carboxylate.
| Compound Name | ethyl (4Z)-4-cyclohexyl-4-hydroxyimino-3-methyl-2-oxobutanoate;ethyl 3-cyclohexyl-4-methyl-1,2-oxazole-5-carboxylate |
|---|---|
| PubChem CID | 87554128 |
| Molecular Formula | C26H40N2O7 |
| Molecular Weight | 492.61 g/mol |
| Exact Mass | 492.28 |
| IUPAC Name | ethyl (4Z)-4-cyclohexyl-4-hydroxyimino-3-methyl-2-oxobutanoate;ethyl 3-cyclohexyl-4-methyl-1,2-oxazole-5-carboxylate |
| SMILES | CCOC(=O)C(=O)C(C)/C(=N\O)C1CCCCC1.CCOC(=O)c1onc(C2CCCCC2)c1C |
| InChI | InChI=1S/C13H21NO4.C13H19NO3/c1-3-18-13(16)12(15)9(2)11(14-17)10-7-5-4-6-8-10;1-3-16-13(15)12-9(2)11(14-17-12)10-7-5-4-6-8-10/h9-10,17H,3-8H2,1-2H3;10H,3-8H2,1-2H3/b14-11+; |
| InChIKey | ZJQYMIQRHMZKQR-JHGYPSGKSA-N |
| XLogP | 5.37 |
| TPSA | 128.29 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 35 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 492.61 |
| LogP ≤ 5 | 5.37 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'diketo_group', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'oxime_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|