C16H25NO3 — CID 101416853
ethyl 4,5,6,7,8,9,10,11,12,13-decahydrocyclododeca[c][1,2]oxazole-3-carboxylate (PubChem CID 101416853) has the molecular formula C16H25NO3 and a molecular weight of 279.38 g/mol. Its IUPAC name is ethyl 4,5,6,7,8,9,10,11,12,13-decahydrocyclododeca[c][1,2]oxazole-3-carboxylate.
| Compound Name | ethyl 4,5,6,7,8,9,10,11,12,13-decahydrocyclododeca[c][1,2]oxazole-3-carboxylate |
|---|---|
| PubChem CID | 101416853 |
| Molecular Formula | C16H25NO3 |
| Molecular Weight | 279.38 g/mol |
| Exact Mass | 279.18 |
| IUPAC Name | ethyl 4,5,6,7,8,9,10,11,12,13-decahydrocyclododeca[c][1,2]oxazole-3-carboxylate |
| SMILES | CCOC(=O)c1onc2c1CCCCCCCCCC2 |
| InChI | InChI=1S/C16H25NO3/c1-2-19-16(18)15-13-11-9-7-5-3-4-6-8-10-12-14(13)17-20-15/h2-12H2,1H3 |
| InChIKey | YDTQRAOFEMDQHA-UHFFFAOYSA-N |
| XLogP | 4.07 |
| TPSA | 52.33 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 279.38 |
| LogP ≤ 5 | 4.07 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |