C9H12Cl2N6OS — CID 87557458
4-[2-(3,5-dichloro-1,2,4-triazol-1-yl)acetyl]piperazine-1-carbothioamide (PubChem CID 87557458) has the molecular formula C9H12Cl2N6OS and a molecular weight of 323.21 g/mol. Its IUPAC name is 4-[2-(3,5-dichloro-1,2,4-triazol-1-yl)acetyl]piperazine-1-carbothioamide.
| Compound Name | 4-[2-(3,5-dichloro-1,2,4-triazol-1-yl)acetyl]piperazine-1-carbothioamide |
|---|---|
| PubChem CID | 87557458 |
| Molecular Formula | C9H12Cl2N6OS |
| Molecular Weight | 323.21 g/mol |
| Exact Mass | 322.02 |
| IUPAC Name | 4-[2-(3,5-dichloro-1,2,4-triazol-1-yl)acetyl]piperazine-1-carbothioamide |
| SMILES | NC(=S)N1CCN(C(=O)Cn2nc(Cl)nc2Cl)CC1 |
| InChI | InChI=1S/C9H12Cl2N6OS/c10-7-13-8(11)17(14-7)5-6(18)15-1-3-16(4-2-15)9(12)19/h1-5H2,(H2,12,19) |
| InChIKey | JBZRGRWWGLFPRH-UHFFFAOYSA-N |
| XLogP | -0.03 |
| TPSA | 80.28 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 323.21 |
| LogP ≤ 5 | -0.03 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|