C18H22O3 — CID 87560248
(8R,9S,13S,14S)-1,4,6-trideuterio-3-deuteriooxy-2-hydroxy-13-methyl-7,8,9,11,12,14,15,16-octahydro-6H-cyclopenta[a]phenanthren-17-one (PubChem CID 87560248) has the molecular formula C18H22O3 and a molecular weight of 290.40 g/mol. Its IUPAC name is (8R,9S,13S,14S)-1,4,6-trideuterio-3-deuteriooxy-2-hydroxy-13-methyl-7,8,9,11,12,14,15,16-octahydro-6H-cyclopenta[a]phenanthren-17-one.
| Compound Name | (8R,9S,13S,14S)-1,4,6-trideuterio-3-deuteriooxy-2-hydroxy-13-methyl-7,8,9,11,12,14,15,16-octahydro-6H-cyclopenta[a]phenanthren-17-one |
|---|---|
| PubChem CID | 87560248 |
| Molecular Formula | C18H22O3 |
| Molecular Weight | 290.40 g/mol |
| Exact Mass | 290.18 |
| IUPAC Name | (8R,9S,13S,14S)-1,4,6-trideuterio-3-deuteriooxy-2-hydroxy-13-methyl-7,8,9,11,12,14,15,16-octahydro-6H-cyclopenta[a]phenanthren-17-one |
| SMILES | [2H]Oc1c([2H])c2c(c([2H])c1O)[C@H]1CC[C@]3(C)C(=O)CC[C@H]3[C@@H]1CC2[2H] |
| InChI | InChI=1S/C18H22O3/c1-18-7-6-11-12(14(18)4-5-17(18)21)3-2-10-8-15(19)16(20)9-13(10)11/h8-9,11-12,14,19-20H,2-7H2,1H3/t11-,12+,14-,18-/m0/s1/i2D,8D,9D/hD/t2?,11-,12+,14-,18- |
| InChIKey | SWINWPBPEKHUOD-KLONYNGLSA-N |
| XLogP | 3.52 |
| TPSA | 57.53 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 290.40 |
| LogP ≤ 5 | 3.52 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'catechol_A(92)', 'substructure': 'N/A'}, {'alert_name': 'catechol', 'substructure': 'N/A'} |
|---|