C13H21ClOS — CID 87562050
2-[[(1S,2R,5S)-6,6-dimethyl-2-bicyclo[3.1.1]heptanyl]methylsulfanyl]propanoyl chloride (PubChem CID 87562050) has the molecular formula C13H21ClOS and a molecular weight of 260.83 g/mol. Its IUPAC name is 2-[[(1S,2R,5S)-6,6-dimethyl-2-bicyclo[3.1.1]heptanyl]methylsulfanyl]propanoyl chloride.
| Compound Name | 2-[[(1S,2R,5S)-6,6-dimethyl-2-bicyclo[3.1.1]heptanyl]methylsulfanyl]propanoyl chloride |
|---|---|
| PubChem CID | 87562050 |
| Molecular Formula | C13H21ClOS |
| Molecular Weight | 260.83 g/mol |
| Exact Mass | 260.10 |
| IUPAC Name | 2-[[(1S,2R,5S)-6,6-dimethyl-2-bicyclo[3.1.1]heptanyl]methylsulfanyl]propanoyl chloride |
| SMILES | CC(SC[C@@H]1CC[C@H]2C[C@@H]1C2(C)C)C(=O)Cl |
| InChI | InChI=1S/C13H21ClOS/c1-8(12(14)15)16-7-9-4-5-10-6-11(9)13(10,2)3/h8-11H,4-7H2,1-3H3/t8?,9-,10-,11-/m0/s1 |
| InChIKey | YRLDWJRPQLBGMG-KQFSYOIOSA-N |
| XLogP | 3.95 |
| TPSA | 17.07 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 260.83 |
| LogP ≤ 5 | 3.95 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'acid_halide', 'substructure': 'N/A'} |
|---|