C19H28N2O4 — CID 87563452
N-hydroxy-3-(4-propanoylphenoxy)-N-(1-pyrrolidin-1-ylpropan-2-yl)propanamide (PubChem CID 87563452) has the molecular formula C19H28N2O4 and a molecular weight of 348.44 g/mol. Its IUPAC name is N-hydroxy-3-(4-propanoylphenoxy)-N-(1-pyrrolidin-1-ylpropan-2-yl)propanamide.
| Compound Name | N-hydroxy-3-(4-propanoylphenoxy)-N-(1-pyrrolidin-1-ylpropan-2-yl)propanamide |
|---|---|
| PubChem CID | 87563452 |
| Molecular Formula | C19H28N2O4 |
| Molecular Weight | 348.44 g/mol |
| Exact Mass | 348.20 |
| IUPAC Name | N-hydroxy-3-(4-propanoylphenoxy)-N-(1-pyrrolidin-1-ylpropan-2-yl)propanamide |
| SMILES | CCC(=O)c1ccc(OCCC(=O)N(O)C(C)CN2CCCC2)cc1 |
| InChI | InChI=1S/C19H28N2O4/c1-3-18(22)16-6-8-17(9-7-16)25-13-10-19(23)21(24)15(2)14-20-11-4-5-12-20/h6-9,15,24H,3-5,10-14H2,1-2H3 |
| InChIKey | YYMSHXVIMICPCI-UHFFFAOYSA-N |
| XLogP | 2.75 |
| TPSA | 70.08 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 348.44 |
| LogP ≤ 5 | 2.75 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'hydroxamic_acid', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|