C17H30N2O — CID 87564300
(2E,4E)-N-piperidin-1-yldodeca-2,4-dienamide (PubChem CID 87564300) has the molecular formula C17H30N2O and a molecular weight of 278.44 g/mol. Its IUPAC name is (2E,4E)-N-piperidin-1-yldodeca-2,4-dienamide.
| Compound Name | (2E,4E)-N-piperidin-1-yldodeca-2,4-dienamide |
|---|---|
| PubChem CID | 87564300 |
| Molecular Formula | C17H30N2O |
| Molecular Weight | 278.44 g/mol |
| Exact Mass | 278.24 |
| IUPAC Name | (2E,4E)-N-piperidin-1-yldodeca-2,4-dienamide |
| SMILES | CCCCCCC/C=C/C=C/C(=O)NN1CCCCC1 |
| InChI | InChI=1S/C17H30N2O/c1-2-3-4-5-6-7-8-9-11-14-17(20)18-19-15-12-10-13-16-19/h8-9,11,14H,2-7,10,12-13,15-16H2,1H3,(H,18,20)/b9-8+,14-11+ |
| InChIKey | LHXDZKKWYJPDJO-HUKVCQRGSA-N |
| XLogP | 3.98 |
| TPSA | 32.34 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 278.44 |
| LogP ≤ 5 | 3.98 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|