C15H28N2O — CID 71766865
(E)-N-piperidin-1-yldec-3-enamide (PubChem CID 71766865) has the molecular formula C15H28N2O and a molecular weight of 252.40 g/mol. Its IUPAC name is (E)-N-piperidin-1-yldec-3-enamide.
| Compound Name | (E)-N-piperidin-1-yldec-3-enamide |
|---|---|
| PubChem CID | 71766865 |
| Molecular Formula | C15H28N2O |
| Molecular Weight | 252.40 g/mol |
| Exact Mass | 252.22 |
| IUPAC Name | (E)-N-piperidin-1-yldec-3-enamide |
| SMILES | CCCCCC/C=C/CC(=O)NN1CCCCC1 |
| InChI | InChI=1S/C15H28N2O/c1-2-3-4-5-6-7-9-12-15(18)16-17-13-10-8-11-14-17/h7,9H,2-6,8,10-14H2,1H3,(H,16,18)/b9-7+ |
| InChIKey | IKUDENDXJQHZNN-VQHVLOKHSA-N |
| XLogP | 3.42 |
| TPSA | 32.34 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 252.40 |
| LogP ≤ 5 | 3.42 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|