C15H26N2O — CID 23071668
(2E,4E)-N-piperidin-1-yldeca-2,4-dienamide (PubChem CID 23071668) has the molecular formula C15H26N2O and a molecular weight of 250.39 g/mol. Its IUPAC name is (2E,4E)-N-piperidin-1-yldeca-2,4-dienamide.
| Compound Name | (2E,4E)-N-piperidin-1-yldeca-2,4-dienamide |
|---|---|
| PubChem CID | 23071668 |
| Molecular Formula | C15H26N2O |
| Molecular Weight | 250.39 g/mol |
| Exact Mass | 250.20 |
| IUPAC Name | (2E,4E)-N-piperidin-1-yldeca-2,4-dienamide |
| SMILES | CCCCC/C=C/C=C/C(=O)NN1CCCCC1 |
| InChI | InChI=1S/C15H26N2O/c1-2-3-4-5-6-7-9-12-15(18)16-17-13-10-8-11-14-17/h6-7,9,12H,2-5,8,10-11,13-14H2,1H3,(H,16,18)/b7-6+,12-9+ |
| InChIKey | FDVZALWPBNHGNH-ZICOIJLXSA-N |
| XLogP | 3.20 |
| TPSA | 32.34 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 250.39 |
| LogP ≤ 5 | 3.20 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|