C14H24N2O — CID 87362083
(2E,4E)-N-pyrrolidin-1-yldeca-2,4-dienamide (PubChem CID 87362083) has the molecular formula C14H24N2O and a molecular weight of 236.36 g/mol. Its IUPAC name is (2E,4E)-N-pyrrolidin-1-yldeca-2,4-dienamide.
| Compound Name | (2E,4E)-N-pyrrolidin-1-yldeca-2,4-dienamide |
|---|---|
| PubChem CID | 87362083 |
| Molecular Formula | C14H24N2O |
| Molecular Weight | 236.36 g/mol |
| Exact Mass | 236.19 |
| IUPAC Name | (2E,4E)-N-pyrrolidin-1-yldeca-2,4-dienamide |
| SMILES | CCCCC/C=C/C=C/C(=O)NN1CCCC1 |
| InChI | InChI=1S/C14H24N2O/c1-2-3-4-5-6-7-8-11-14(17)15-16-12-9-10-13-16/h6-8,11H,2-5,9-10,12-13H2,1H3,(H,15,17)/b7-6+,11-8+ |
| InChIKey | KYPXLBVTJRZANG-HRCSPUOPSA-N |
| XLogP | 2.81 |
| TPSA | 32.34 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 236.36 |
| LogP ≤ 5 | 2.81 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|