C18H31N4O15P3 — CID 87565007
[[7-amino-1-[(2S,3S,5R)-5-[5-(3-aminoprop-2-enyl)-2,4-dioxopyrimidin-1-yl]-3-hydroxyoxolan-2-yl]-2-oxoheptoxy]-hydroxyphosphoryl] phosphono hydrogen phosphate (PubChem CID 87565007) has the molecular formula C18H31N4O15P3 and a molecular weight of 636.38 g/mol. Its IUPAC name is [[7-amino-1-[(2S,3S,5R)-5-[5-(3-aminoprop-2-enyl)-2,4-dioxopyrimidin-1-yl]-3-hydroxyoxolan-2-yl]-2-oxoheptoxy]-hydroxyphosphoryl] phosphono hydrogen phosphate.
| Compound Name | [[7-amino-1-[(2S,3S,5R)-5-[5-(3-aminoprop-2-enyl)-2,4-dioxopyrimidin-1-yl]-3-hydroxyoxolan-2-yl]-2-oxoheptoxy]-hydroxyphosphoryl] phosphono hydrogen phosphate |
|---|---|
| PubChem CID | 87565007 |
| Molecular Formula | C18H31N4O15P3 |
| Molecular Weight | 636.38 g/mol |
| Exact Mass | 636.10 |
| IUPAC Name | [[7-amino-1-[(2S,3S,5R)-5-[5-(3-aminoprop-2-enyl)-2,4-dioxopyrimidin-1-yl]-3-hydroxyoxolan-2-yl]-2-oxoheptoxy]-hydroxyphosphoryl] phosphono hydrogen phosphate |
| SMILES | NC=CCc1cn([C@H]2C[C@H](O)[C@@H](C(OP(=O)(O)OP(=O)(O)OP(=O)(O)O)C(=O)CCCCCN)O2)c(=O)[nH]c1=O |
| InChI | InChI=1S/C18H31N4O15P3/c19-7-3-1-2-6-12(23)16(35-39(30,31)37-40(32,33)36-38(27,28)29)15-13(24)9-14(34-15)22-10-11(5-4-8-20)17(25)21-18(22)26/h4,8,10,13-16,24H,1-3,5-7,9,19-20H2,(H,30,31)(H,32,33)(H,21,25,26)(H2,27,28,29)/t13-,14+,15-,16?/m0/s1 |
| InChIKey | QLYWWCKOLXMDJV-QGPPMGRFSA-N |
| XLogP | -1.00 |
| TPSA | 313.25 Ų |
| H-Bond Donors | 8 |
| H-Bond Acceptors | 14 |
| Rotatable Bonds | 16 |
| Heavy Atoms | 40 |
| Complexity | — |
3 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 636.38 |
| LogP ≤ 5 | -1.00 |
| H-Bond Donors ≤ 5 | 8 |
| H-Bond Acceptors ≤ 10 | 14 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|