C31H49NOSi — CID 87570102
(8R,9R,10R,13S,14S)-10,13-dimethyl-15,16-dimethylidene-3-tri(propan-2-yl)silyloxy-2,3,4,7,8,9,11,12,14,17-decahydro-1H-cyclopenta[a]phenanthrene-17-carbonitrile (PubChem CID 87570102) has the molecular formula C31H49NOSi and a molecular weight of 479.83 g/mol. Its IUPAC name is (8R,9R,10R,13S,14S)-10,13-dimethyl-15,16-dimethylidene-3-tri(propan-2-yl)silyloxy-2,3,4,7,8,9,11,12,14,17-decahydro-1H-cyclopenta[a]phenanthrene-17-carbonitrile.
| Compound Name | (8R,9R,10R,13S,14S)-10,13-dimethyl-15,16-dimethylidene-3-tri(propan-2-yl)silyloxy-2,3,4,7,8,9,11,12,14,17-decahydro-1H-cyclopenta[a]phenanthrene-17-carbonitrile |
|---|---|
| PubChem CID | 87570102 |
| Molecular Formula | C31H49NOSi |
| Molecular Weight | 479.83 g/mol |
| Exact Mass | 479.36 |
| IUPAC Name | (8R,9R,10R,13S,14S)-10,13-dimethyl-15,16-dimethylidene-3-tri(propan-2-yl)silyloxy-2,3,4,7,8,9,11,12,14,17-decahydro-1H-cyclopenta[a]phenanthrene-17-carbonitrile |
| SMILES | C=C1C(=C)[C@H]2[C@@H]3CC=C4CC(O[Si](C(C)C)(C(C)C)C(C)C)CC[C@]4(C)[C@@H]3CC[C@]2(C)C1C#N |
| InChI | InChI=1S/C31H49NOSi/c1-19(2)34(20(3)4,21(5)6)33-25-13-15-30(9)24(17-25)11-12-26-27(30)14-16-31(10)28(18-32)22(7)23(8)29(26)31/h11,19-21,25-29H,7-8,12-17H2,1-6,9-10H3/t25?,26-,27-,28?,29+,30+,31-/m1/s1 |
| InChIKey | LTESJNLUZYBBTO-JTYKFNNVSA-N |
| XLogP | 8.98 |
| TPSA | 33.02 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 479.83 |
| LogP ≤ 5 | 8.98 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|