C25H28O3Si2 — CID 87574675
(E)-3-[dimethyl(triphenylsilyloxy)silyl]-2-methylbut-2-enoic acid (PubChem CID 87574675) has the molecular formula C25H28O3Si2 and a molecular weight of 432.67 g/mol. Its IUPAC name is (E)-3-[dimethyl(triphenylsilyloxy)silyl]-2-methylbut-2-enoic acid.
| Compound Name | (E)-3-[dimethyl(triphenylsilyloxy)silyl]-2-methylbut-2-enoic acid |
|---|---|
| PubChem CID | 87574675 |
| Molecular Formula | C25H28O3Si2 |
| Molecular Weight | 432.67 g/mol |
| Exact Mass | 432.16 |
| IUPAC Name | (E)-3-[dimethyl(triphenylsilyloxy)silyl]-2-methylbut-2-enoic acid |
| SMILES | C/C(C(=O)O)=C(/C)[Si](C)(C)O[Si](c1ccccc1)(c1ccccc1)c1ccccc1 |
| InChI | InChI=1S/C25H28O3Si2/c1-20(25(26)27)21(2)29(3,4)28-30(22-14-8-5-9-15-22,23-16-10-6-11-17-23)24-18-12-7-13-19-24/h5-19H,1-4H3,(H,26,27)/b21-20+ |
| InChIKey | PIYSYOXSONBNRD-QZQOTICOSA-N |
| XLogP | 3.84 |
| TPSA | 46.53 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 432.67 |
| LogP ≤ 5 | 3.84 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'triphenyl_methyl-silyl', 'substructure': 'N/A'} |
|---|