C20H27N2O3+ — CID 87585426
ethyl 2-[3-[2-(4-methylphenyl)-2-oxoethyl]imidazol-3-ium-1-yl]hexanoate (PubChem CID 87585426) has the molecular formula C20H27N2O3+ and a molecular weight of 343.45 g/mol. Its IUPAC name is ethyl 2-[3-[2-(4-methylphenyl)-2-oxoethyl]imidazol-3-ium-1-yl]hexanoate.
| Compound Name | ethyl 2-[3-[2-(4-methylphenyl)-2-oxoethyl]imidazol-3-ium-1-yl]hexanoate |
|---|---|
| PubChem CID | 87585426 |
| Molecular Formula | C20H27N2O3+ |
| Molecular Weight | 343.45 g/mol |
| Exact Mass | 343.20 |
| IUPAC Name | ethyl 2-[3-[2-(4-methylphenyl)-2-oxoethyl]imidazol-3-ium-1-yl]hexanoate |
| SMILES | CCCCC(C(=O)OCC)n1cc[n+](CC(=O)c2ccc(C)cc2)c1 |
| InChI | InChI=1S/C20H27N2O3/c1-4-6-7-18(20(24)25-5-2)22-13-12-21(15-22)14-19(23)17-10-8-16(3)9-11-17/h8-13,15,18H,4-7,14H2,1-3H3/q+1 |
| InChIKey | MCTTVZDBYNZRJJ-UHFFFAOYSA-N |
| XLogP | 3.26 |
| TPSA | 52.18 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 343.45 |
| LogP ≤ 5 | 3.26 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|