C25H22F3N3O4 — CID 87592085
N-[2-(3-carbamimidoylphenoxy)ethyl]-2,2,2-trifluoro-N-[4-(4-methoxybenzoyl)phenyl]acetamide (PubChem CID 87592085) has the molecular formula C25H22F3N3O4 and a molecular weight of 485.46 g/mol. Its IUPAC name is N-[2-(3-carbamimidoylphenoxy)ethyl]-2,2,2-trifluoro-N-[4-(4-methoxybenzoyl)phenyl]acetamide.
| Compound Name | N-[2-(3-carbamimidoylphenoxy)ethyl]-2,2,2-trifluoro-N-[4-(4-methoxybenzoyl)phenyl]acetamide |
|---|---|
| PubChem CID | 87592085 |
| Molecular Formula | C25H22F3N3O4 |
| Molecular Weight | 485.46 g/mol |
| Exact Mass | 485.16 |
| IUPAC Name | N-[2-(3-carbamimidoylphenoxy)ethyl]-2,2,2-trifluoro-N-[4-(4-methoxybenzoyl)phenyl]acetamide |
| SMILES | [H]/N=C(\N)c1cccc(OCCN(C(=O)C(F)(F)F)c2ccc(C(=O)c3ccc(OC)cc3)cc2)c1 |
| InChI | InChI=1S/C25H22F3N3O4/c1-34-20-11-7-17(8-12-20)22(32)16-5-9-19(10-6-16)31(24(33)25(26,27)28)13-14-35-21-4-2-3-18(15-21)23(29)30/h2-12,15H,13-14H2,1H3,(H3,29,30) |
| InChIKey | RAZQEHBPARNVOD-UHFFFAOYSA-N |
| XLogP | 4.18 |
| TPSA | 105.71 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 35 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 485.46 |
| LogP ≤ 5 | 4.18 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|