C18H13Cl2F2NO3 — CID 87593087
2-[2-(3,4-dichlorophenyl)-4-(3,4-difluorophenyl)-5-oxomorpholin-2-yl]acetaldehyde (PubChem CID 87593087) has the molecular formula C18H13Cl2F2NO3 and a molecular weight of 400.21 g/mol. Its IUPAC name is 2-[2-(3,4-dichlorophenyl)-4-(3,4-difluorophenyl)-5-oxomorpholin-2-yl]acetaldehyde.
| Compound Name | 2-[2-(3,4-dichlorophenyl)-4-(3,4-difluorophenyl)-5-oxomorpholin-2-yl]acetaldehyde |
|---|---|
| PubChem CID | 87593087 |
| Molecular Formula | C18H13Cl2F2NO3 |
| Molecular Weight | 400.21 g/mol |
| Exact Mass | 399.02 |
| IUPAC Name | 2-[2-(3,4-dichlorophenyl)-4-(3,4-difluorophenyl)-5-oxomorpholin-2-yl]acetaldehyde |
| SMILES | O=CCC1(c2ccc(Cl)c(Cl)c2)CN(c2ccc(F)c(F)c2)C(=O)CO1 |
| InChI | InChI=1S/C18H13Cl2F2NO3/c19-13-3-1-11(7-14(13)20)18(5-6-24)10-23(17(25)9-26-18)12-2-4-15(21)16(22)8-12/h1-4,6-8H,5,9-10H2 |
| InChIKey | MFBHDBQNHOMFAZ-UHFFFAOYSA-N |
| XLogP | 4.12 |
| TPSA | 46.61 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 400.21 |
| LogP ≤ 5 | 4.12 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|