C16H22N4O3S2 — CID 87597603
4-[3-[[(3,4,5-trimethyl-1,3-thiazol-2-ylidene)hydrazinylidene]methyl]pyridin-1-ium-1-yl]butane-1-sulfonate (PubChem CID 87597603) has the molecular formula C16H22N4O3S2 and a molecular weight of 382.51 g/mol. Its IUPAC name is 4-[3-[[(3,4,5-trimethyl-1,3-thiazol-2-ylidene)hydrazinylidene]methyl]pyridin-1-ium-1-yl]butane-1-sulfonate.
| Compound Name | 4-[3-[[(3,4,5-trimethyl-1,3-thiazol-2-ylidene)hydrazinylidene]methyl]pyridin-1-ium-1-yl]butane-1-sulfonate |
|---|---|
| PubChem CID | 87597603 |
| Molecular Formula | C16H22N4O3S2 |
| Molecular Weight | 382.51 g/mol |
| Exact Mass | 382.11 |
| IUPAC Name | 4-[3-[[(3,4,5-trimethyl-1,3-thiazol-2-ylidene)hydrazinylidene]methyl]pyridin-1-ium-1-yl]butane-1-sulfonate |
| SMILES | Cc1sc(=NN=Cc2ccc[n+](CCCCS(=O)(=O)[O-])c2)n(C)c1C |
| InChI | InChI=1S/C16H22N4O3S2/c1-13-14(2)24-16(19(13)3)18-17-11-15-7-6-9-20(12-15)8-4-5-10-25(21,22)23/h6-7,9,11-12H,4-5,8,10H2,1-3H3 |
| InChIKey | YRIQFZWIYQTBEB-UHFFFAOYSA-N |
| XLogP | 1.25 |
| TPSA | 90.73 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 382.51 |
| LogP ≤ 5 | 1.25 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'thiaz_ene_A(128)', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|