C21H23NO2 — CID 87605436
(E)-7-[ethyl(naphthalen-1-yl)amino]-2,2-dimethylhept-5-en-3-ynoic acid (PubChem CID 87605436) has the molecular formula C21H23NO2 and a molecular weight of 321.42 g/mol. Its IUPAC name is (E)-7-[ethyl(naphthalen-1-yl)amino]-2,2-dimethylhept-5-en-3-ynoic acid.
| Compound Name | (E)-7-[ethyl(naphthalen-1-yl)amino]-2,2-dimethylhept-5-en-3-ynoic acid |
|---|---|
| PubChem CID | 87605436 |
| Molecular Formula | C21H23NO2 |
| Molecular Weight | 321.42 g/mol |
| Exact Mass | 321.17 |
| IUPAC Name | (E)-7-[ethyl(naphthalen-1-yl)amino]-2,2-dimethylhept-5-en-3-ynoic acid |
| SMILES | CCN(C/C=C/C#CC(C)(C)C(=O)O)c1cccc2ccccc12 |
| InChI | InChI=1S/C21H23NO2/c1-4-22(16-9-5-8-15-21(2,3)20(23)24)19-14-10-12-17-11-6-7-13-18(17)19/h5-7,9-14H,4,16H2,1-3H3,(H,23,24)/b9-5+ |
| InChIKey | YMROAFBUTVZZAW-WEVVVXLNSA-N |
| XLogP | 4.34 |
| TPSA | 40.54 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 321.42 |
| LogP ≤ 5 | 4.34 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|