C22H38OSi — CID 87614571
tert-butyl-[(E)-hexadec-6-en-8,10-diynoxy]-dimethylsilane (PubChem CID 87614571) has the molecular formula C22H38OSi and a molecular weight of 346.63 g/mol. Its IUPAC name is tert-butyl-[(E)-hexadec-6-en-8,10-diynoxy]-dimethylsilane.
| Compound Name | tert-butyl-[(E)-hexadec-6-en-8,10-diynoxy]-dimethylsilane |
|---|---|
| PubChem CID | 87614571 |
| Molecular Formula | C22H38OSi |
| Molecular Weight | 346.63 g/mol |
| Exact Mass | 346.27 |
| IUPAC Name | tert-butyl-[(E)-hexadec-6-en-8,10-diynoxy]-dimethylsilane |
| SMILES | CCCCCC#CC#C/C=C/CCCCCO[Si](C)(C)C(C)(C)C |
| InChI | InChI=1S/C22H38OSi/c1-7-8-9-10-11-12-13-14-15-16-17-18-19-20-21-23-24(5,6)22(2,3)4/h15-16H,7-10,17-21H2,1-6H3/b16-15+ |
| InChIKey | FXOIKMSHAMAZEA-FOCLMDBBSA-N |
| XLogP | 6.71 |
| TPSA | 9.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 24 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 346.63 |
| LogP ≤ 5 | 6.71 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|