C19H29FN2O4 — CID 87616017
5-amino-6-(3-fluorophenyl)-N,4-dihydroxy-2-(1-hydroxy-4-methylcyclohexyl)hexanamide (PubChem CID 87616017) has the molecular formula C19H29FN2O4 and a molecular weight of 368.45 g/mol. Its IUPAC name is 5-amino-6-(3-fluorophenyl)-N,4-dihydroxy-2-(1-hydroxy-4-methylcyclohexyl)hexanamide.
| Compound Name | 5-amino-6-(3-fluorophenyl)-N,4-dihydroxy-2-(1-hydroxy-4-methylcyclohexyl)hexanamide |
|---|---|
| PubChem CID | 87616017 |
| Molecular Formula | C19H29FN2O4 |
| Molecular Weight | 368.45 g/mol |
| Exact Mass | 368.21 |
| IUPAC Name | 5-amino-6-(3-fluorophenyl)-N,4-dihydroxy-2-(1-hydroxy-4-methylcyclohexyl)hexanamide |
| SMILES | CC1CCC(O)(C(CC(O)C(N)Cc2cccc(F)c2)C(=O)NO)CC1 |
| InChI | InChI=1S/C19H29FN2O4/c1-12-5-7-19(25,8-6-12)15(18(24)22-26)11-17(23)16(21)10-13-3-2-4-14(20)9-13/h2-4,9,12,15-17,23,25-26H,5-8,10-11,21H2,1H3,(H,22,24) |
| InChIKey | OWBVJOLXLUMYNA-UHFFFAOYSA-N |
| XLogP | 1.51 |
| TPSA | 115.81 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 368.45 |
| LogP ≤ 5 | 1.51 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'hydroxamic_acid', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|