C20H32N2O4 — CID 87616266
(2S,4S,5S)-5-amino-N,4-dihydroxy-2-(1-hydroxy-3,5-dimethylcyclohexyl)-6-phenylhexanamide (PubChem CID 87616266) has the molecular formula C20H32N2O4 and a molecular weight of 364.49 g/mol. Its IUPAC name is (2S,4S,5S)-5-amino-N,4-dihydroxy-2-(1-hydroxy-3,5-dimethylcyclohexyl)-6-phenylhexanamide.
| Compound Name | (2S,4S,5S)-5-amino-N,4-dihydroxy-2-(1-hydroxy-3,5-dimethylcyclohexyl)-6-phenylhexanamide |
|---|---|
| PubChem CID | 87616266 |
| Molecular Formula | C20H32N2O4 |
| Molecular Weight | 364.49 g/mol |
| Exact Mass | 364.24 |
| IUPAC Name | (2S,4S,5S)-5-amino-N,4-dihydroxy-2-(1-hydroxy-3,5-dimethylcyclohexyl)-6-phenylhexanamide |
| SMILES | CC1CC(C)CC(O)([C@H](C[C@H](O)[C@@H](N)Cc2ccccc2)C(=O)NO)C1 |
| InChI | InChI=1S/C20H32N2O4/c1-13-8-14(2)12-20(25,11-13)16(19(24)22-26)10-18(23)17(21)9-15-6-4-3-5-7-15/h3-7,13-14,16-18,23,25-26H,8-12,21H2,1-2H3,(H,22,24)/t13?,14?,16-,17+,18+,20?/m1/s1 |
| InChIKey | AZOSRZRDGUGHEZ-WSTISNGDSA-N |
| XLogP | 1.62 |
| TPSA | 115.81 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 364.49 |
| LogP ≤ 5 | 1.62 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'hydroxamic_acid', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|