C21H32N2O4 — CID 87616550
(2S,4S,5S)-5-amino-N,4-dihydroxy-2-(9-hydroxy-9-bicyclo[3.3.1]nonanyl)-6-phenylhexanamide (PubChem CID 87616550) has the molecular formula C21H32N2O4 and a molecular weight of 376.50 g/mol. Its IUPAC name is (2S,4S,5S)-5-amino-N,4-dihydroxy-2-(9-hydroxy-9-bicyclo[3.3.1]nonanyl)-6-phenylhexanamide.
| Compound Name | (2S,4S,5S)-5-amino-N,4-dihydroxy-2-(9-hydroxy-9-bicyclo[3.3.1]nonanyl)-6-phenylhexanamide |
|---|---|
| PubChem CID | 87616550 |
| Molecular Formula | C21H32N2O4 |
| Molecular Weight | 376.50 g/mol |
| Exact Mass | 376.24 |
| IUPAC Name | (2S,4S,5S)-5-amino-N,4-dihydroxy-2-(9-hydroxy-9-bicyclo[3.3.1]nonanyl)-6-phenylhexanamide |
| SMILES | N[C@@H](Cc1ccccc1)[C@@H](O)CC(C(=O)NO)C1(O)C2CCCC1CCC2 |
| InChI | InChI=1S/C21H32N2O4/c22-18(12-14-6-2-1-3-7-14)19(24)13-17(20(25)23-27)21(26)15-8-4-9-16(21)11-5-10-15/h1-3,6-7,15-19,24,26-27H,4-5,8-13,22H2,(H,23,25)/t15?,16?,17?,18-,19-,21?/m0/s1 |
| InChIKey | UIQVPXNRBAUVDV-VQIYKNCMSA-N |
| XLogP | 1.76 |
| TPSA | 115.81 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 376.50 |
| LogP ≤ 5 | 1.76 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'hydroxamic_acid', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|