C14H35N15 — CID 87616224
2-methyl-1-[1,2,4,4-tetrakis[(N'-methylcarbamimidoyl)amino]butan-2-yl]guanidine (PubChem CID 87616224) has the molecular formula C14H35N15 and a molecular weight of 413.54 g/mol. Its IUPAC name is 2-methyl-1-[1,2,4,4-tetrakis[(N'-methylcarbamimidoyl)amino]butan-2-yl]guanidine.
| Compound Name | 2-methyl-1-[1,2,4,4-tetrakis[(N'-methylcarbamimidoyl)amino]butan-2-yl]guanidine |
|---|---|
| PubChem CID | 87616224 |
| Molecular Formula | C14H35N15 |
| Molecular Weight | 413.54 g/mol |
| Exact Mass | 413.32 |
| IUPAC Name | 2-methyl-1-[1,2,4,4-tetrakis[(N'-methylcarbamimidoyl)amino]butan-2-yl]guanidine |
| SMILES | C/N=C(/N)NC(CN/C(N)=N/C)(CC(N/C(N)=N/C)N/C(N)=N/C)N/C(N)=N/C |
| InChI | InChI=1S/C14H35N15/c1-20-9(15)25-7-14(28-12(18)23-4,29-13(19)24-5)6-8(26-10(16)21-2)27-11(17)22-3/h8H,6-7H2,1-5H3,(H3,15,20,25)(H3,16,21,26)(H3,17,22,27)(H3,18,23,28)(H3,19,24,29) |
| InChIKey | IHSKLINODUWURY-UHFFFAOYSA-N |
| XLogP | -4.93 |
| TPSA | 252.05 Ų |
| H-Bond Donors | 10 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 413.54 |
| LogP ≤ 5 | -4.93 |
| H-Bond Donors ≤ 5 | 10 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|