C29H24F6N4O3 — CID 87617143
[2-[methyl(naphthalene-1-carbonyl)amino]-5,6,7,8-tetrahydroimidazo[1,2-a]pyridin-3-yl] N-[[3,5-bis(trifluoromethyl)phenyl]methyl]carbamate (PubChem CID 87617143) has the molecular formula C29H24F6N4O3 and a molecular weight of 590.52 g/mol. Its IUPAC name is [2-[methyl(naphthalene-1-carbonyl)amino]-5,6,7,8-tetrahydroimidazo[1,2-a]pyridin-3-yl] N-[[3,5-bis(trifluoromethyl)phenyl]methyl]carbamate.
| Compound Name | [2-[methyl(naphthalene-1-carbonyl)amino]-5,6,7,8-tetrahydroimidazo[1,2-a]pyridin-3-yl] N-[[3,5-bis(trifluoromethyl)phenyl]methyl]carbamate |
|---|---|
| PubChem CID | 87617143 |
| Molecular Formula | C29H24F6N4O3 |
| Molecular Weight | 590.52 g/mol |
| Exact Mass | 590.18 |
| IUPAC Name | [2-[methyl(naphthalene-1-carbonyl)amino]-5,6,7,8-tetrahydroimidazo[1,2-a]pyridin-3-yl] N-[[3,5-bis(trifluoromethyl)phenyl]methyl]carbamate |
| SMILES | CN(C(=O)c1cccc2ccccc12)c1nc2n(c1OC(=O)NCc1cc(C(F)(F)F)cc(C(F)(F)F)c1)CCCC2 |
| InChI | InChI=1S/C29H24F6N4O3/c1-38(25(40)22-10-6-8-18-7-2-3-9-21(18)22)24-26(39-12-5-4-11-23(39)37-24)42-27(41)36-16-17-13-19(28(30,31)32)15-20(14-17)29(33,34)35/h2-3,6-10,13-15H,4-5,11-12,16H2,1H3,(H,36,41) |
| InChIKey | FBAAHBWDHJPDNI-UHFFFAOYSA-N |
| XLogP | 6.98 |
| TPSA | 76.46 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 42 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 590.52 |
| LogP ≤ 5 | 6.98 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |