C14H9Cl2NO4 — CID 87619166
(1R,2R,6S,7S,8S,10R)-4-(3,5-dichlorophenyl)-9,11-dioxa-4-azatetracyclo[5.3.1.02,6.08,10]undecane-3,5-dione (PubChem CID 87619166) has the molecular formula C14H9Cl2NO4 and a molecular weight of 326.14 g/mol. Its IUPAC name is (1R,2R,6S,7S,8S,10R)-4-(3,5-dichlorophenyl)-9,11-dioxa-4-azatetracyclo[5.3.1.02,6.08,10]undecane-3,5-dione.
| Compound Name | (1R,2R,6S,7S,8S,10R)-4-(3,5-dichlorophenyl)-9,11-dioxa-4-azatetracyclo[5.3.1.02,6.08,10]undecane-3,5-dione |
|---|---|
| PubChem CID | 87619166 |
| Molecular Formula | C14H9Cl2NO4 |
| Molecular Weight | 326.14 g/mol |
| Exact Mass | 324.99 |
| IUPAC Name | (1R,2R,6S,7S,8S,10R)-4-(3,5-dichlorophenyl)-9,11-dioxa-4-azatetracyclo[5.3.1.02,6.08,10]undecane-3,5-dione |
| SMILES | O=C1[C@@H]2[C@@H]3O[C@@H]([C@H]4O[C@H]43)[C@@H]2C(=O)N1c1cc(Cl)cc(Cl)c1 |
| InChI | InChI=1S/C14H9Cl2NO4/c15-4-1-5(16)3-6(2-4)17-13(18)7-8(14(17)19)10-12-11(21-12)9(7)20-10/h1-3,7-12H/t7-,8+,9-,10+,11-,12+ |
| InChIKey | VUDJOGZPDSJNAO-CJXDBHJTSA-N |
| XLogP | 1.65 |
| TPSA | 59.14 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 326.14 |
| LogP ≤ 5 | 1.65 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'}, {'alert_name': 'Three-membered_heterocycle', 'substructure': 'N/A'} |
|---|