C28H33F2N3O5S — CID 87619884
N-[2-[2-[1-(3,4-difluorophenyl)-3,4-dihydro-1H-pyrrolo[1,2-a]pyrazin-2-yl]-2-oxoethoxy]ethyl]-4-methoxy-N,2,3,6-tetramethylbenzenesulfonamide (PubChem CID 87619884) has the molecular formula C28H33F2N3O5S and a molecular weight of 561.65 g/mol. Its IUPAC name is N-[2-[2-[1-(3,4-difluorophenyl)-3,4-dihydro-1H-pyrrolo[1,2-a]pyrazin-2-yl]-2-oxoethoxy]ethyl]-4-methoxy-N,2,3,6-tetramethylbenzenesulfonamide.
| Compound Name | N-[2-[2-[1-(3,4-difluorophenyl)-3,4-dihydro-1H-pyrrolo[1,2-a]pyrazin-2-yl]-2-oxoethoxy]ethyl]-4-methoxy-N,2,3,6-tetramethylbenzenesulfonamide |
|---|---|
| PubChem CID | 87619884 |
| Molecular Formula | C28H33F2N3O5S |
| Molecular Weight | 561.65 g/mol |
| Exact Mass | 561.21 |
| IUPAC Name | N-[2-[2-[1-(3,4-difluorophenyl)-3,4-dihydro-1H-pyrrolo[1,2-a]pyrazin-2-yl]-2-oxoethoxy]ethyl]-4-methoxy-N,2,3,6-tetramethylbenzenesulfonamide |
| SMILES | COc1cc(C)c(S(=O)(=O)N(C)CCOCC(=O)N2CCn3cccc3C2c2ccc(F)c(F)c2)c(C)c1C |
| InChI | InChI=1S/C28H33F2N3O5S/c1-18-15-25(37-5)19(2)20(3)28(18)39(35,36)31(4)13-14-38-17-26(34)33-12-11-32-10-6-7-24(32)27(33)21-8-9-22(29)23(30)16-21/h6-10,15-16,27H,11-14,17H2,1-5H3 |
| InChIKey | FISNGGZCZNMGBC-UHFFFAOYSA-N |
| XLogP | 3.97 |
| TPSA | 81.08 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 39 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 561.65 |
| LogP ≤ 5 | 3.97 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|