C30H39N3O5S — CID 87619093
4-methoxy-N,2,3,6-tetramethyl-N-[2-[2-oxo-2-[1-(2-phenylethyl)-3,4-dihydro-1H-pyrrolo[1,2-a]pyrazin-2-yl]ethoxy]ethyl]benzenesulfonamide (PubChem CID 87619093) has the molecular formula C30H39N3O5S and a molecular weight of 553.73 g/mol. Its IUPAC name is 4-methoxy-N,2,3,6-tetramethyl-N-[2-[2-oxo-2-[1-(2-phenylethyl)-3,4-dihydro-1H-pyrrolo[1,2-a]pyrazin-2-yl]ethoxy]ethyl]benzenesulfonamide.
| Compound Name | 4-methoxy-N,2,3,6-tetramethyl-N-[2-[2-oxo-2-[1-(2-phenylethyl)-3,4-dihydro-1H-pyrrolo[1,2-a]pyrazin-2-yl]ethoxy]ethyl]benzenesulfonamide |
|---|---|
| PubChem CID | 87619093 |
| Molecular Formula | C30H39N3O5S |
| Molecular Weight | 553.73 g/mol |
| Exact Mass | 553.26 |
| IUPAC Name | 4-methoxy-N,2,3,6-tetramethyl-N-[2-[2-oxo-2-[1-(2-phenylethyl)-3,4-dihydro-1H-pyrrolo[1,2-a]pyrazin-2-yl]ethoxy]ethyl]benzenesulfonamide |
| SMILES | COc1cc(C)c(S(=O)(=O)N(C)CCOCC(=O)N2CCn3cccc3C2CCc2ccccc2)c(C)c1C |
| InChI | InChI=1S/C30H39N3O5S/c1-22-20-28(37-5)23(2)24(3)30(22)39(35,36)31(4)18-19-38-21-29(34)33-17-16-32-15-9-12-26(32)27(33)14-13-25-10-7-6-8-11-25/h6-12,15,20,27H,13-14,16-19,21H2,1-5H3 |
| InChIKey | OHHNEYJMGYHOQT-UHFFFAOYSA-N |
| XLogP | 4.28 |
| TPSA | 81.08 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 39 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 553.73 |
| LogP ≤ 5 | 4.28 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|